A phosphate phosphite is a chemical compound or salt that contains phosphate and phosphite anions (PO33- and PO43-). These are mixed anion compounds or mixed valence compounds. Some have third anions.
Phosphate phosphites frequently occur as metal organic framework (MOF) compounds which are of research interest for gas storage, detection or catalysis. In these phosphate and phosphite form bridging ligands to hard metal ions. Protonated amines are templates. [1]
An phosphate phosphite compound may also be called a phosphite phosphate.
Phosphate phosphite compounds are frequently produced by hydrothermal synthesis, in which a water solution of ingredients is enclosed in a sealed container and heated. Phosphate may be reduced to phosphite or phosphite oxidised to phosphate in this process.
On heating,
Related to these are the nitrite nitrates and arsenate arsenites.
name | formula | ratio
PO4:PO3 |
mw | system | space group | unit cell Å | volume | density | properties | references |
---|---|---|---|---|---|---|---|---|---|---|
1,4-diammoniumbutane | [(H3N(CH2)4NH3)2][Sc5F4(HPO3)6(H2PO3)2(PO4)] | 1:8 | 1300.8 | monoclinic | C2/m | a=12.888 b=14.835 c=10.531 β=103.093 Z=2 @93K | 1961.2 | [2] | ||
imidazole | [C3N2H52[VIII4(H2O)3(HPO3)4(HPO4)3] | 3:4 | 1003.766 | trigonal | P3c1 | a=13.499 c=18.120 Z=12 | 2280.35 | 2.143 | green | [3] |
(C3H10NO)6[V8(H2O)6(PO4)2(HPO3)12] | 2:12 | P3c1 | a=13.5393 c=18.2283 | 2893.8 | green | [4] | ||||
(C4H8N2)3[V8(H2O)6(PO4)2(HPO3)12] | 2:12 | P3c1 | a=13.4922 c=18.3589 | 2894.3 | green | [4] | ||||
Mn5(μ-OH2)2(PO4)2(HPO3)2·2H2O | 2:2 | [5] | ||||||||
Iron(III) 2,2'-bipyridine Phosphite−Phosphate | [FeIII(2,2'-bipyridine)(HPO3)(H2PO4)] | 1:1 | monoclinic | a=10.5407 b=6.4298 c=10.6172 β=113.890 Z=2 | 1.878 | colourless | [6] | |||
FeIII(1,10-phenanthroline)(HPO3)(H2PO3) | 1:1 | monoclinic | P21/m | a = 10.180, b = 6.424, c = 11.6668, β = 115.59°, Z = 4, | 668.2 | 1.880 | yellow | [7] | ||
{[C3H4N22[C5NH514[H15(Mo2O4)8Co16(PO4)14(HPO3)10(OH)3]}·5H2O | 14:10 | 6685.09 | monoclinic | C2/m | a=29.724 b=24.623 c=20.687 β=126.760 Z=2 | 12130 | 1.830 | red | [8] | |
tris (4-pyridyl) triazine zinc phosphate–phosphite | C54 H60 N18 O42 P10 Zn9 | ? | 2531.23 | hexagonal | P63 | a=15.6464 c=19.788 Z=2 | 4195.2 | yellow | [9] | |
1-(2-Aminoethyl) piperazine tetrazinc diphosphate diphosphite | (C6H17N3)[Zn4(PO4)2(HPO3)2] | 2:2 | monoclinic | Cc | a=5.327, b=17.146, c=22.071, β=94.58°, Z=4 | 2009.5 | [10] | |||
Zinc Phosphate-phosphite (trans-C6H15N2)2Zn4(PO4)2(HPO3)2 | (C6H15N2)2Zn4(PO4)2(HPO3)2 | 2:2 | 841.78 | monoclinic | P21/n | a=9.706 b=9.993 c=27.557 β=96.795 Z=4 | 2654.0 | 2.107 | [11] | |
1,3-cyclohexanebis(methylamine); | [H2CHBMA][Zn1.5Mn(HPO3)2.5(PO4)]•5H2O | 1:5 | monoclinic | C2/c | a=33.929, b=13.045, c=8.971, β=104.37°, Z=2 | 3846.5 | [12] | |||
2-hydroxypropylammonium dizinc hydrogenphosphite phosphate | [C3H6(OH)NH3][Zn2(HPO3)(PO4)] | 1:1 | triclinic | P1 | a =5.302 b =8.934 c =12.686, α =74.35° β =88.54° γ =73.94° | [13] | ||||
TJPU-3Mn
(bis(Cyclohexane-1,3-bis(methylammonium)) bis(μ4-phosphato)-tetrakis(μ3-hydrogen phosphito)-manganese-tetra-zinc dihydrate) |
[H2CHBMA][Zn2Mn0.5(PO4)(HPO3)2]·H2O | 1:2 | monoclinic | C2/c | a = 33.929, b = 13.045, c = 8.971, β = 104.37°, Z = 4 | 3846 | [14] | |||
triethylenetetramine | [C6N4H220.5[Zn3(PO4)2(HPO3)] | 2:1 | [15] | |||||||
zinc potassium phosphitephosphate | [16] | |||||||||
N,N,N′,N′-tetramethylenediamine (TMEDA) | (C6N2H18)2(C6N2H17)Ga15(OH)8(PO4)2(HPO4)12(HPO3)6·2H2O | 14:6 | P3 | a = 19.046, c = 8.331, Z = 1 | 2617.1 | [17] | ||||
Zirconium phosphate phosphite | γ-ZrPO4·HPO2(OH)·2H2O | 1:1 | layered | [18] | ||||||
phen = 1,10-phenanthroline | Cd2(phen)2(H2PO4)(H2PO3)(C2O4) | 1:1 | chains | [19] | ||||||
catena-(tris(hexane-1,6-diaminium) octakis(μ3-phosphonato)-hexakis(μ3-phosphato)-tris(μ2-hydrogen phosphato)-hexa-aqua-nona-indium | [In9(H2O)6(HPO3)13(H2PO3)2(PO4)(HPO4)][(C6N2H18)3] | 2:15 | hexagonal | P63/m | a=13.7676 c=28.062 | [20] | ||||
4-bipyridine | (C10H10N2)1.5(H3O)3[In18(H2O)12(HPO4)12(HPO3)16(H2PO3)6] | 12:16 | hexagonal | P63/m | a = 13.784, c = 28.058 | 4617 | [21] | |||
catena-(bis(propane-1,3-diammonium) octakis(μ3-phosphito)-pentakis(μ2-hydrogen phosphito)-(μ2-dihydrogen phosphato)-hexa-indium) | [In6(HPO3)8(H2PO3)5(H2PO4)]·(C3N2H12)2 | 1:11 | orthorhombic | Pna21 | a = 26.7974, b = 9.8459, c = 18.5441, Z = 4 | 4892.8 | [22] | |||
Pb2Al(HPO3)3(H2PO4) | 1:3 | orthorhombic | Cmcm | [23] | ||||||
Pb2Ga(HPO3)3(H2PO4) | 1:3 | orthorhombic | Cmcm | |||||||
Pb2Al(HPO3)2(HPO4)(H2PO4) | 2:2 | orthorhombic | Cmcm | |||||||
Rubidium Uranium(VI/IV) Phosphate-Phosphite | Rb2[(UO2)2(UIV)(PO4)2(HPO3)2(H2O)] | 2:2 | 1316.94 | monoclinic | C2/c | a=16.2421 b=10.5049 c=11.0936 β=98.745 | 1870.8 | 4.702 | orange-yellow | [24] |
Cesium Uranium(IV) Phosphate-Phosphite | Cs2[UIV3(PO4)2(HPO3)4] | 2:4 | 1489.76 | monoclinic | C2/m | a=25.7396 b=5.5906 c=7.6334 β=98.964 Z=2 | 1085.03 | 4.560 | blue-green | [24] |
Cesium Uranium(VI/IV) Phosphate-Phosphite | Cs2[(UO2)(UIV)(HPO4)2(HPO3)2] | 2:2 | 1123.78 | triclinic | P1 | a=6.8571 b=11.1190 c=12.0391 alpha=63.861 beta=77.481 gamma=79.331 Z=2 | 800.22 | 4.664 | Yellow-Orange | [24] |
Cs4[(UO2)8(HPO4)5(HPO3)5]·4H2O | 5:5 | monoclinic | C2/c | a 18.5005Å b 10.971 c 14.4752, β 104.513° | yellow | [25] | ||||
Cs4[UIV6(PO4)8(HPO4)(HPO3)] | 9:1 | orthorhombic | Pmmn | a 6.9321 b 26.935 c 10.9137 | pale green | [25] | ||||
Cs10[UIV10(PO4)4(HPO4)14(HPO3)5]·H2O | 15:5 | monoclinic | C2/m | a 19.2966 b 20.2914 c 13.9293 β 126.839° | green | [25] | ||||
Tl3[(UO2)2(H1.5PO4)(H0.5PO4)(H1.5PO3)2] | 2:2 | 1503.07 | tetragonal | P42/mbc | a=13.5382 c=19.4008 Z=8 | 3555.8 | 5.615 | Yellow-green | [26] | |
Tl2[(UO2)2(UIV)(H2O)(PO4)2(HPO3)2] | 2:2 | 1550.71 | monoclinic | C2/c | a=16.2360 b=10.4995 c=11.0003 β=99.027 Z=4 | 1851.99 | 5.562 | light green | [26] |