![]() | |
Names | |
---|---|
IUPAC name
Ethyl 2-methylpentanoate
| |
Other names
Ethyl α-methylvalerate; Melon valerate
| |
Identifiers | |
3D model (
JSmol)
|
|
ChemSpider | |
ECHA InfoCard | 100.049.422 |
EC Number |
|
PubChem
CID
|
|
UNII | |
CompTox Dashboard (
EPA)
|
|
| |
| |
Properties | |
C8H16O2 | |
Molar mass | 144.21 g/mol |
Density | 0.861-0.865 g/mL (25°C) |
Boiling point | 156-157°C |
Except where otherwise noted, data are given for materials in their
standard state (at 25 °C [77 °F], 100 kPa).
|
Ethyl 2-methylvalerate ( systematically ethyl 2-methylpentanoate, commonly referred to as manzanate) is the organic compound with the formula CH3CH2CH2(H3C)CHCO2CH2CH3. [1] This colorless liquid has a fruity apple smell and with aspects of cider and sweet pineapple. [2] It is commonly used as a flavoring agent, but has a wide range of applications. [3] 2-Methylpentanoic acid esters have at least 2 enantiomers. It is common for enantiomers to have distinct or similar smells. [4]
It is commonly produced in the esterification of 2-methylpentanoic acid by dry ethyl alcohol, with mineral acids catalyzing the reaction.
It can be obtained by vacuum distillation from the reaction between sodium salt of the respective acid with diethyl sulfate.